C23H29ClO2 — CID 18696682
5-(4-chloro-2-ethyl-2,6,7-trimethyl-1,3-dihydroinden-5-yl)-2-propanoylcyclohex-2-en-1-one (PubChem CID 18696682) has the molecular formula C23H29ClO2 and a molecular weight of 372.94 g/mol. Its IUPAC name is 5-(4-chloro-2-ethyl-2,6,7-trimethyl-1,3-dihydroinden-5-yl)-2-propanoylcyclohex-2-en-1-one.
| Compound Name | 5-(4-chloro-2-ethyl-2,6,7-trimethyl-1,3-dihydroinden-5-yl)-2-propanoylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 18696682 |
| Molecular Formula | C23H29ClO2 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 5-(4-chloro-2-ethyl-2,6,7-trimethyl-1,3-dihydroinden-5-yl)-2-propanoylcyclohex-2-en-1-one |
| SMILES | CCC(=O)C1=CCC(c2c(C)c(C)c3c(c2Cl)CC(C)(CC)C3)CC1=O |
| InChI | InChI=1S/C23H29ClO2/c1-6-19(25)16-9-8-15(10-20(16)26)21-14(4)13(3)17-11-23(5,7-2)12-18(17)22(21)24/h9,15H,6-8,10-12H2,1-5H3 |
| InChIKey | VWDQABFUQDLLHS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|