C10H7N5O2 — CID 18697783
7-amino-2,5-dihydrotriazolo[4,5-c][1]benzazepine-4,10-dione (PubChem CID 18697783) has the molecular formula C10H7N5O2 and a molecular weight of 229.20 g/mol. Its IUPAC name is 7-amino-2,5-dihydrotriazolo[4,5-c][1]benzazepine-4,10-dione.
| Compound Name | 7-amino-2,5-dihydrotriazolo[4,5-c][1]benzazepine-4,10-dione |
|---|---|
| PubChem CID | 18697783 |
| Molecular Formula | C10H7N5O2 |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 7-amino-2,5-dihydrotriazolo[4,5-c][1]benzazepine-4,10-dione |
| SMILES | Nc1ccc2c(=O)c3n[nH]nc3c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H7N5O2/c11-4-1-2-5-6(3-4)12-10(17)8-7(9(5)16)13-15-14-8/h1-3H,11H2,(H,12,17)(H,13,14,15) |
| InChIKey | IAPXIAUWVSXGMZ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|