C26H23N7O4 — CID 18697896
3-[1-[(4-methoxyphenyl)methyl]-4,10-dioxo-5H-triazolo[4,5-c][1]benzazepin-7-yl]-N'-pyridin-4-ylpropanehydrazide (PubChem CID 18697896) has the molecular formula C26H23N7O4 and a molecular weight of 497.52 g/mol. Its IUPAC name is 3-[1-[(4-methoxyphenyl)methyl]-4,10-dioxo-5H-triazolo[4,5-c][1]benzazepin-7-yl]-N'-pyridin-4-ylpropanehydrazide.
| Compound Name | 3-[1-[(4-methoxyphenyl)methyl]-4,10-dioxo-5H-triazolo[4,5-c][1]benzazepin-7-yl]-N'-pyridin-4-ylpropanehydrazide |
|---|---|
| PubChem CID | 18697896 |
| Molecular Formula | C26H23N7O4 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 3-[1-[(4-methoxyphenyl)methyl]-4,10-dioxo-5H-triazolo[4,5-c][1]benzazepin-7-yl]-N'-pyridin-4-ylpropanehydrazide |
| SMILES | COc1ccc(Cn2nnc3c(=O)[nH]c4cc(CCC(=O)NNc5ccncc5)ccc4c(=O)c32)cc1 |
| InChI | InChI=1S/C26H23N7O4/c1-37-19-6-2-17(3-7-19)15-33-24-23(31-32-33)26(36)28-21-14-16(4-8-20(21)25(24)35)5-9-22(34)30-29-18-10-12-27-13-11-18/h2-4,6-8,10-14H,5,9,15H2,1H3,(H,27,29)(H,28,36)(H,30,34) |
| InChIKey | HNHYIXZJFSQUBH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|