C17H16ClF6N5O8S — CID 18698217
2-[[4-[carbamimidoyl(chloro)amino]isoquinolin-7-yl]sulfonyl-methylamino]acetic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18698217) has the molecular formula C17H16ClF6N5O8S and a molecular weight of 599.85 g/mol. Its IUPAC name is 2-[[4-[carbamimidoyl(chloro)amino]isoquinolin-7-yl]sulfonyl-methylamino]acetic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[4-[carbamimidoyl(chloro)amino]isoquinolin-7-yl]sulfonyl-methylamino]acetic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18698217 |
| Molecular Formula | C17H16ClF6N5O8S |
| Molecular Weight | 599.85 g/mol |
| Exact Mass | 599.03 |
| IUPAC Name | 2-[[4-[carbamimidoyl(chloro)amino]isoquinolin-7-yl]sulfonyl-methylamino]acetic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)N(Cl)c1cncc2cc(S(=O)(=O)N(C)CC(=O)O)ccc12 |
| InChI | InChI=1S/C13H14ClN5O4S.2C2HF3O2/c1-18(7-12(20)21)24(22,23)9-2-3-10-8(4-9)5-17-6-11(10)19(14)13(15)16;2*3-2(4,5)1(6)7/h2-6H,7H2,1H3,(H3,15,16)(H,20,21);2*(H,6,7) |
| InChIKey | JIAYNFKVHBVFPN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 215.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.85 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|