About butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate
butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate (PubChem CID 18698311) has the molecular formula C23H22Cl2N2O3
and a molecular weight of 445.35 g/mol. Its IUPAC name is butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate |
| PubChem CID | 18698311 |
| Molecular Formula | C23H22Cl2N2O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate |
| SMILES | CCCCOC(=O)CC(NC(=O)c1ccc2c(Cl)cnc(Cl)c2c1)c1ccccc1 |
| InChI | InChI=1S/C23H22Cl2N2O3/c1-2-3-11-30-21(28)13-20(15-7-5-4-6-8-15)27-23(29)16-9-10-17-18(12-16)22(25)26-14-19(17)24/h4-10,12,14,20H,2-3,11,13H2,1H3,(H,27,29) |
| InChIKey | HWHNDQRGAGRQNZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate?
The IUPAC name of butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate (CID 18698311) is butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate.
What is the SMILES notation for butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate?
The canonical SMILES for butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate is CCCCOC(=O)CC(NC(=O)c1ccc2c(Cl)cnc(Cl)c2c1)c1ccccc1.
What is the InChIKey of butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate?
The InChIKey is HWHNDQRGAGRQNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22Cl2N2O3/c1-2-3-11-30-21(28)13-20(15-7-5-4-6-8-15)27-23(29)16-9-10-17-18(12-16)22(25)26-14-19(17)24/h4-10,12,14,20H,2-3,11,13H2,1H3,(H,27,29).
What are the key properties of butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate?
butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate has a molecular weight of 445.35 g/mol, XLogP of 5.75, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-[(1,4-dichloroisoquinoline-7-carbonyl)amino]-3-phenylpropanoate is sourced from PubChem (CID 18698311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).