About 2-chloro-3,4,5-trifluoropyridine
2-chloro-3,4,5-trifluoropyridine (PubChem CID 18698768) has the molecular formula C5HClF3N
and a molecular weight of 167.52 g/mol. Its IUPAC name is 2-chloro-3,4,5-trifluoropyridine.
Molecular Properties
| Compound Name | 2-chloro-3,4,5-trifluoropyridine |
| PubChem CID | 18698768 |
| Molecular Formula | C5HClF3N |
| Molecular Weight | 167.52 g/mol |
| Exact Mass | 166.97 |
| IUPAC Name | 2-chloro-3,4,5-trifluoropyridine |
| SMILES | Fc1cnc(Cl)c(F)c1F |
| InChI | InChI=1S/C5HClF3N/c6-5-4(9)3(8)2(7)1-10-5/h1H |
| InChIKey | QILWNYPOUSQEPT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,4,5-trifluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,4,5-trifluoropyridine?
The IUPAC name of 2-chloro-3,4,5-trifluoropyridine (CID 18698768) is 2-chloro-3,4,5-trifluoropyridine.
What is the SMILES notation for 2-chloro-3,4,5-trifluoropyridine?
The canonical SMILES for 2-chloro-3,4,5-trifluoropyridine is Fc1cnc(Cl)c(F)c1F.
What is the InChIKey of 2-chloro-3,4,5-trifluoropyridine?
The InChIKey is QILWNYPOUSQEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HClF3N/c6-5-4(9)3(8)2(7)1-10-5/h1H.
What are the key properties of 2-chloro-3,4,5-trifluoropyridine?
2-chloro-3,4,5-trifluoropyridine has a molecular weight of 167.52 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,4,5-trifluoropyridine is sourced from PubChem (CID 18698768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).