C12H15N3O3S3 — CID 18699107
3-[2,4,6-trioxo-3,5-bis(3-sulfanylidenepropyl)-1,3,5-triazinan-1-yl]propanethial (PubChem CID 18699107) has the molecular formula C12H15N3O3S3 and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-[2,4,6-trioxo-3,5-bis(3-sulfanylidenepropyl)-1,3,5-triazinan-1-yl]propanethial.
| Compound Name | 3-[2,4,6-trioxo-3,5-bis(3-sulfanylidenepropyl)-1,3,5-triazinan-1-yl]propanethial |
|---|---|
| PubChem CID | 18699107 |
| Molecular Formula | C12H15N3O3S3 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 3-[2,4,6-trioxo-3,5-bis(3-sulfanylidenepropyl)-1,3,5-triazinan-1-yl]propanethial |
| SMILES | O=c1n(CCC=S)c(=O)n(CCC=S)c(=O)n1CCC=S |
| InChI | InChI=1S/C12H15N3O3S3/c16-10-13(4-1-7-19)11(17)15(6-3-9-21)12(18)14(10)5-2-8-20/h7-9H,1-6H2 |
| InChIKey | GIHNEOXBSCMHTD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|