About 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran
5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran (PubChem CID 18699187) has the molecular formula C15H21BrO
and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran.
Molecular Properties
| Compound Name | 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran |
| PubChem CID | 18699187 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran |
| SMILES | Cc1c(Br)cc2c(c1C(C)(C)C)OCC2(C)C |
| InChI | InChI=1S/C15H21BrO/c1-9-11(16)7-10-13(12(9)14(2,3)4)17-8-15(10,5)6/h7H,8H2,1-6H3 |
| InChIKey | PJNHSDLAZHJIEA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran?
The IUPAC name of 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran (CID 18699187) is 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran.
What is the SMILES notation for 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran?
The canonical SMILES for 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran is Cc1c(Br)cc2c(c1C(C)(C)C)OCC2(C)C.
What is the InChIKey of 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran?
The InChIKey is PJNHSDLAZHJIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrO/c1-9-11(16)7-10-13(12(9)14(2,3)4)17-8-15(10,5)6/h7H,8H2,1-6H3.
What are the key properties of 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran?
5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran has a molecular weight of 297.24 g/mol, XLogP of 4.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-tert-butyl-3,3,6-trimethyl-2H-1-benzofuran is sourced from PubChem (CID 18699187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).