About 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline
2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline (PubChem CID 18699529) has the molecular formula C17H22N2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline.
Molecular Properties
| Compound Name | 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline |
| PubChem CID | 18699529 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(Cc2cc(C)cc(C)c2N)c1 |
| InChI | InChI=1S/C17H22N2/c1-10-5-12(3)16(18)14(7-10)9-15-8-11(2)6-13(4)17(15)19/h5-8H,9,18-19H2,1-4H3 |
| InChIKey | MAUWEKGDVIGQJT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline?
The IUPAC name of 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline (CID 18699529) is 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline.
What is the SMILES notation for 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline?
The canonical SMILES for 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline is Cc1cc(C)c(N)c(Cc2cc(C)cc(C)c2N)c1.
What is the InChIKey of 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline?
The InChIKey is MAUWEKGDVIGQJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2/c1-10-5-12(3)16(18)14(7-10)9-15-8-11(2)6-13(4)17(15)19/h5-8H,9,18-19H2,1-4H3.
What are the key properties of 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline?
2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline has a molecular weight of 254.38 g/mol, XLogP of 3.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-3,5-dimethylphenyl)methyl]-4,6-dimethylaniline is sourced from PubChem (CID 18699529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).