About N-hexyl-7H-purin-6-amine
N-hexyl-7H-purin-6-amine (PubChem CID 1870) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is N-hexyl-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-hexyl-7H-purin-6-amine |
| PubChem CID | 1870 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N-hexyl-7H-purin-6-amine |
| SMILES | CCCCCCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C11H17N5/c1-2-3-4-5-6-12-10-9-11(14-7-13-9)16-8-15-10/h7-8H,2-6H2,1H3,(H2,12,13,14,15,16) |
| InChIKey | SSVCRPKUKBLUMH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-7H-purin-6-amine?
The IUPAC name of N-hexyl-7H-purin-6-amine (CID 1870) is N-hexyl-7H-purin-6-amine.
What is the SMILES notation for N-hexyl-7H-purin-6-amine?
The canonical SMILES for N-hexyl-7H-purin-6-amine is CCCCCCNc1ncnc2nc[nH]c12.
What is the InChIKey of N-hexyl-7H-purin-6-amine?
The InChIKey is SSVCRPKUKBLUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5/c1-2-3-4-5-6-12-10-9-11(14-7-13-9)16-8-15-10/h7-8H,2-6H2,1H3,(H2,12,13,14,15,16).
What are the key properties of N-hexyl-7H-purin-6-amine?
N-hexyl-7H-purin-6-amine has a molecular weight of 219.29 g/mol, XLogP of 2.35, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-7H-purin-6-amine is sourced from PubChem (CID 1870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).