About 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride
2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride (PubChem CID 18700041) has the molecular formula C15H22Cl2N2S2
and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride |
| PubChem CID | 18700041 |
| Molecular Formula | C15H22Cl2N2S2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride |
| SMILES | Cc1csc(-c2ccc(CN3CCCCCC3)s2)n1.Cl.Cl |
| InChI | InChI=1S/C15H20N2S2.2ClH/c1-12-11-18-15(16-12)14-7-6-13(19-14)10-17-8-4-2-3-5-9-17;;/h6-7,11H,2-5,8-10H2,1H3;2*1H |
| InChIKey | JIPVRUWMILOXKT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride?
The IUPAC name of 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride (CID 18700041) is 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride.
What is the SMILES notation for 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride?
The canonical SMILES for 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride is Cc1csc(-c2ccc(CN3CCCCCC3)s2)n1.Cl.Cl.
What is the InChIKey of 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride?
The InChIKey is JIPVRUWMILOXKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2S2.2ClH/c1-12-11-18-15(16-12)14-7-6-13(19-14)10-17-8-4-2-3-5-9-17;;/h6-7,11H,2-5,8-10H2,1H3;2*1H.
What are the key properties of 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride?
2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride has a molecular weight of 365.40 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(azepan-1-ylmethyl)thiophen-2-yl]-4-methyl-1,3-thiazole;dihydrochloride is sourced from PubChem (CID 18700041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).