About methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride
methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride (PubChem CID 18700149) has the molecular formula C11H13ClF3NO3
and a molecular weight of 299.68 g/mol. Its IUPAC name is methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride |
| PubChem CID | 18700149 |
| Molecular Formula | C11H13ClF3NO3 |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride |
| SMILES | COC(=O)Cc1ccc(N)cc1OCC(F)(F)F.Cl |
| InChI | InChI=1S/C11H12F3NO3.ClH/c1-17-10(16)4-7-2-3-8(15)5-9(7)18-6-11(12,13)14;/h2-3,5H,4,6,15H2,1H3;1H |
| InChIKey | PWUBNUUNYACMGU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride?
The IUPAC name of methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride (CID 18700149) is methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride.
What is the SMILES notation for methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride?
The canonical SMILES for methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride is COC(=O)Cc1ccc(N)cc1OCC(F)(F)F.Cl.
What is the InChIKey of methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride?
The InChIKey is PWUBNUUNYACMGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO3.ClH/c1-17-10(16)4-7-2-3-8(15)5-9(7)18-6-11(12,13)14;/h2-3,5H,4,6,15H2,1H3;1H.
What are the key properties of methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride?
methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride has a molecular weight of 299.68 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-amino-2-(2,2,2-trifluoroethoxy)phenyl]acetate;hydrochloride is sourced from PubChem (CID 18700149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).