About methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate
methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate (PubChem CID 18700280) has the molecular formula C15H19ClF3N3O4
and a molecular weight of 397.78 g/mol. Its IUPAC name is methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate.
Molecular Properties
| Compound Name | methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate |
| PubChem CID | 18700280 |
| Molecular Formula | C15H19ClF3N3O4 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate |
| SMILES | COC(=O)C(C)(NC(=O)C(C)Oc1ncnc(C(F)(F)F)c1Cl)C(C)C |
| InChI | InChI=1S/C15H19ClF3N3O4/c1-7(2)14(4,13(24)25-5)22-11(23)8(3)26-12-9(16)10(15(17,18)19)20-6-21-12/h6-8H,1-5H3,(H,22,23) |
| InChIKey | HSAFWLLWWLPDAO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate?
The IUPAC name of methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate (CID 18700280) is methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate.
What is the SMILES notation for methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate?
The canonical SMILES for methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate is COC(=O)C(C)(NC(=O)C(C)Oc1ncnc(C(F)(F)F)c1Cl)C(C)C.
What is the InChIKey of methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate?
The InChIKey is HSAFWLLWWLPDAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClF3N3O4/c1-7(2)14(4,13(24)25-5)22-11(23)8(3)26-12-9(16)10(15(17,18)19)20-6-21-12/h6-8H,1-5H3,(H,22,23).
What are the key properties of methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate?
methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate has a molecular weight of 397.78 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[5-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoylamino]-2,3-dimethylbutanoate is sourced from PubChem (CID 18700280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).