C17H19ClN2O2 — CID 18700401
bicyclo[2.2.0]hexa-1,3,5-triene;1-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidin-1-yl]ethanone (PubChem CID 18700401) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;1-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidin-1-yl]ethanone.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;1-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 18700401 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;1-[4-[4-(chloromethyl)-1,3-oxazol-2-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2nc(CCl)co2)CC1.c1cc2ccc1-2 |
| InChI | InChI=1S/C11H15ClN2O2.C6H4/c1-8(15)14-4-2-9(3-5-14)11-13-10(6-12)7-16-11;1-2-6-4-3-5(1)6/h7,9H,2-6H2,1H3;1-4H |
| InChIKey | WRMGSYOAKVVTRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|