C24H28F2N4O2 — CID 18700854
2-[6-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-3-pyridinyl]benzoic acid (PubChem CID 18700854) has the molecular formula C24H28F2N4O2 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-[6-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-3-pyridinyl]benzoic acid.
| Compound Name | 2-[6-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 18700854 |
| Molecular Formula | C24H28F2N4O2 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-[6-[[5-(1,1-difluorobutyl)-2-pentyl-1,2,4-triazol-3-yl]methyl]-3-pyridinyl]benzoic acid |
| SMILES | CCCCCn1nc(C(F)(F)CCC)nc1Cc1ccc(-c2ccccc2C(=O)O)cn1 |
| InChI | InChI=1S/C24H28F2N4O2/c1-3-5-8-14-30-21(28-23(29-30)24(25,26)13-4-2)15-18-12-11-17(16-27-18)19-9-6-7-10-20(19)22(31)32/h6-7,9-12,16H,3-5,8,13-15H2,1-2H3,(H,31,32) |
| InChIKey | PNUGHCBQGKZARI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|