C28H28N4O3 — CID 18701132
2-[5-[[2-pentyl-5-(2-phenylacetyl)-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid (PubChem CID 18701132) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-[5-[[2-pentyl-5-(2-phenylacetyl)-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid.
| Compound Name | 2-[5-[[2-pentyl-5-(2-phenylacetyl)-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 18701132 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2-[5-[[2-pentyl-5-(2-phenylacetyl)-1,2,4-triazol-3-yl]methyl]-2-pyridinyl]benzoic acid |
| SMILES | CCCCCn1nc(C(=O)Cc2ccccc2)nc1Cc1ccc(-c2ccccc2C(=O)O)nc1 |
| InChI | InChI=1S/C28H28N4O3/c1-2-3-9-16-32-26(30-27(31-32)25(33)17-20-10-5-4-6-11-20)18-21-14-15-24(29-19-21)22-12-7-8-13-23(22)28(34)35/h4-8,10-15,19H,2-3,9,16-18H2,1H3,(H,34,35) |
| InChIKey | OADOPUGTRBNHLG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|