C24H28N4O3 — CID 18701404
3-[4-[(5-butanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-4-carboxylic acid (PubChem CID 18701404) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-[4-[(5-butanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-4-carboxylic acid.
| Compound Name | 3-[4-[(5-butanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 18701404 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-[4-[(5-butanoyl-2-pentyl-1,2,4-triazol-3-yl)methyl]phenyl]pyridine-4-carboxylic acid |
| SMILES | CCCCCn1nc(C(=O)CCC)nc1Cc1ccc(-c2cnccc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-3-5-6-14-28-22(26-23(27-28)21(29)7-4-2)15-17-8-10-18(11-9-17)20-16-25-13-12-19(20)24(30)31/h8-13,16H,3-7,14-15H2,1-2H3,(H,30,31) |
| InChIKey | PXBDMNKSOVSJOP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|