About 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide
4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide (PubChem CID 18701737) has the molecular formula C24H22N2O5S
and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide |
| PubChem CID | 18701737 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide |
| SMILES | COc1cccc(OC)c1-c1nc(Cc2ccccc2)oc1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c1-29-19-9-6-10-20(30-2)22(19)23-24(17-11-13-18(14-12-17)32(25,27)28)31-21(26-23)15-16-7-4-3-5-8-16/h3-14H,15H2,1-2H3,(H2,25,27,28) |
| InChIKey | OCKFNLYLXNRDQD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide?
The IUPAC name of 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide (CID 18701737) is 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide.
What is the SMILES notation for 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide?
The canonical SMILES for 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide is COc1cccc(OC)c1-c1nc(Cc2ccccc2)oc1-c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide?
The InChIKey is OCKFNLYLXNRDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O5S/c1-29-19-9-6-10-20(30-2)22(19)23-24(17-11-13-18(14-12-17)32(25,27)28)31-21(26-23)15-16-7-4-3-5-8-16/h3-14H,15H2,1-2H3,(H2,25,27,28).
What are the key properties of 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide?
4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide has a molecular weight of 450.52 g/mol, XLogP of 4.26, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-benzyl-4-(2,6-dimethoxyphenyl)-1,3-oxazol-5-yl]benzenesulfonamide is sourced from PubChem (CID 18701737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).