C24H22N2O5S — CID 18701883
4-[2-benzyl-5-(3,5-dimethoxyphenyl)-1,3-oxazol-4-yl]benzenesulfonamide (PubChem CID 18701883) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-[2-benzyl-5-(3,5-dimethoxyphenyl)-1,3-oxazol-4-yl]benzenesulfonamide.
| Compound Name | 4-[2-benzyl-5-(3,5-dimethoxyphenyl)-1,3-oxazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 18701883 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-[2-benzyl-5-(3,5-dimethoxyphenyl)-1,3-oxazol-4-yl]benzenesulfonamide |
| SMILES | COc1cc(OC)cc(-c2oc(Cc3ccccc3)nc2-c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C24H22N2O5S/c1-29-19-13-18(14-20(15-19)30-2)24-23(17-8-10-21(11-9-17)32(25,27)28)26-22(31-24)12-16-6-4-3-5-7-16/h3-11,13-15H,12H2,1-2H3,(H2,25,27,28) |
| InChIKey | UICQOVUXPYPDMW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |