About 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole
2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole (PubChem CID 18701888) has the molecular formula C25H23NO3S
and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole |
| PubChem CID | 18701888 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole |
| SMILES | Cc1ccc(C)c(-c2nc(Cc3ccccc3)oc2-c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C25H23NO3S/c1-17-9-10-18(2)22(15-17)24-25(20-11-13-21(14-12-20)30(3,27)28)29-23(26-24)16-19-7-5-4-6-8-19/h4-15H,16H2,1-3H3 |
| InChIKey | WZLHWTYLUVGUQU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole?
The IUPAC name of 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole (CID 18701888) is 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole.
What is the SMILES notation for 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole?
The canonical SMILES for 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole is Cc1ccc(C)c(-c2nc(Cc3ccccc3)oc2-c2ccc(S(C)(=O)=O)cc2)c1.
What is the InChIKey of 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole?
The InChIKey is WZLHWTYLUVGUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO3S/c1-17-9-10-18(2)22(15-17)24-25(20-11-13-21(14-12-20)30(3,27)28)29-23(26-24)16-19-7-5-4-6-8-19/h4-15H,16H2,1-3H3.
What are the key properties of 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole?
2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole has a molecular weight of 417.53 g/mol, XLogP of 5.62, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-(2,5-dimethylphenyl)-5-(4-methylsulfonylphenyl)-1,3-oxazole is sourced from PubChem (CID 18701888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).