C27H34 — CID 18702077
2-[(3,5-dimethylcyclohexa-1,3-dien-1-yl)-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 18702077) has the molecular formula C27H34 and a molecular weight of 358.57 g/mol. Its IUPAC name is 2-[(3,5-dimethylcyclohexa-1,3-dien-1-yl)-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[(3,5-dimethylcyclohexa-1,3-dien-1-yl)-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 18702077 |
| Molecular Formula | C27H34 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 2-[(3,5-dimethylcyclohexa-1,3-dien-1-yl)-(2,4,6-trimethylphenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | CC1=CC(C)CC(C(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)=C1 |
| InChI | InChI=1S/C27H34/c1-16-9-17(2)15-24(14-16)27(25-20(5)10-18(3)11-21(25)6)26-22(7)12-19(4)13-23(26)8/h9-14,17,27H,15H2,1-8H3 |
| InChIKey | NYHSVDZHHIZJEI-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |