About 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one
4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one (PubChem CID 18702139) has the molecular formula C14H20O8
and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one |
| PubChem CID | 18702139 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(OCC2(COC3COC(=O)O3)CCCCC2)O1 |
| InChI | InChI=1S/C14H20O8/c15-12-17-6-10(21-12)19-8-14(4-2-1-3-5-14)9-20-11-7-18-13(16)22-11/h10-11H,1-9H2 |
| InChIKey | MVJOUROJJWPSSC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one?
The IUPAC name of 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one (CID 18702139) is 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one.
What is the SMILES notation for 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one?
The canonical SMILES for 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one is O=C1OCC(OCC2(COC3COC(=O)O3)CCCCC2)O1.
What is the InChIKey of 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one?
The InChIKey is MVJOUROJJWPSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O8/c15-12-17-6-10(21-12)19-8-14(4-2-1-3-5-14)9-20-11-7-18-13(16)22-11/h10-11H,1-9H2.
What are the key properties of 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one?
4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one has a molecular weight of 316.31 g/mol, XLogP of 1.96, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-[(2-oxo-1,3-dioxolan-4-yl)oxymethyl]cyclohexyl]methoxy]-1,3-dioxolan-2-one is sourced from PubChem (CID 18702139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).