C10H14O4 — CID 18702169
1,3,5-trimethoxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 18702169) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1,3,5-trimethoxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1,3,5-trimethoxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 18702169 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,3,5-trimethoxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | COC1=CC(C=O)(OC)CC(OC)=C1 |
| InChI | InChI=1S/C10H14O4/c1-12-8-4-9(13-2)6-10(5-8,7-11)14-3/h4-5,7H,6H2,1-3H3 |
| InChIKey | PLTSNKHBCZEGFS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|