C21H27Cl2N3 — CID 18702291
N,N-dimethyl-4-[(6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methyl]aniline;dihydrochloride (PubChem CID 18702291) has the molecular formula C21H27Cl2N3 and a molecular weight of 392.37 g/mol. Its IUPAC name is N,N-dimethyl-4-[(6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methyl]aniline;dihydrochloride.
| Compound Name | N,N-dimethyl-4-[(6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 18702291 |
| Molecular Formula | C21H27Cl2N3 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N,N-dimethyl-4-[(6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)methyl]aniline;dihydrochloride |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCNC3Cc1ccc(N(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C21H25N3.2ClH/c1-14-4-9-19-18(12-14)17-10-11-22-20(21(17)23-19)13-15-5-7-16(8-6-15)24(2)3;;/h4-9,12,20,22-23H,10-11,13H2,1-3H3;2*1H |
| InChIKey | UDVVSVKNIRZMBE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|