C20H32 — CID 18702495
3,7,7-trimethylbicyclo[4.1.0]hept-2-ene;3,7,7-trimethylbicyclo[4.1.0]hept-3-ene (PubChem CID 18702495) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 3,7,7-trimethylbicyclo[4.1.0]hept-2-ene;3,7,7-trimethylbicyclo[4.1.0]hept-3-ene.
| Compound Name | 3,7,7-trimethylbicyclo[4.1.0]hept-2-ene;3,7,7-trimethylbicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 18702495 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 3,7,7-trimethylbicyclo[4.1.0]hept-2-ene;3,7,7-trimethylbicyclo[4.1.0]hept-3-ene |
| SMILES | CC1=CC2C(CC1)C2(C)C.CC1=CCC2C(C1)C2(C)C |
| InChI | InChI=1S/2C10H16/c2*1-7-4-5-8-9(6-7)10(8,2)3/h6,8-9H,4-5H2,1-3H3;4,8-9H,5-6H2,1-3H3 |
| InChIKey | IATAAHQAQITUBP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|