C19H29F3 — CID 18702610
1,2,3-trifluoro-3-(4-heptylcyclohexyl)cyclohexa-1,4-diene (PubChem CID 18702610) has the molecular formula C19H29F3 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1,2,3-trifluoro-3-(4-heptylcyclohexyl)cyclohexa-1,4-diene.
| Compound Name | 1,2,3-trifluoro-3-(4-heptylcyclohexyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 18702610 |
| Molecular Formula | C19H29F3 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1,2,3-trifluoro-3-(4-heptylcyclohexyl)cyclohexa-1,4-diene |
| SMILES | CCCCCCCC1CCC(C2(F)C=CCC(F)=C2F)CC1 |
| InChI | InChI=1S/C19H29F3/c1-2-3-4-5-6-8-15-10-12-16(13-11-15)19(22)14-7-9-17(20)18(19)21/h7,14-16H,2-6,8-13H2,1H3 |
| InChIKey | ZAAPVLWYINQHLN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|