C12H7F15O2 — CID 18702679
5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methylideneundecanoic acid (PubChem CID 18702679) has the molecular formula C12H7F15O2 and a molecular weight of 468.16 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methylideneundecanoic acid.
| Compound Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methylideneundecanoic acid |
|---|---|
| PubChem CID | 18702679 |
| Molecular Formula | C12H7F15O2 |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methylideneundecanoic acid |
| SMILES | C=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H7F15O2/c1-4(5(28)29)2-3-6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h1-3H2,(H,28,29) |
| InChIKey | RKJUFBHBMXQPLC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|