C34H40O10 — CID 18703967
9-formyl-2-[[9-hydroxy-8-(2-phenylacetyl)oxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid (PubChem CID 18703967) has the molecular formula C34H40O10 and a molecular weight of 608.68 g/mol. Its IUPAC name is 9-formyl-2-[[9-hydroxy-8-(2-phenylacetyl)oxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid.
| Compound Name | 9-formyl-2-[[9-hydroxy-8-(2-phenylacetyl)oxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 18703967 |
| Molecular Formula | C34H40O10 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | 9-formyl-2-[[9-hydroxy-8-(2-phenylacetyl)oxy-2,4,6-trioxatricyclo[3.3.1.03,7]nonan-5-yl]oxymethyl]-5-methyl-13-propan-2-yltetracyclo[7.4.0.02,11.04,8]tridec-12-ene-1-carboxylic acid |
| SMILES | CC(C)C1=CC2CC3(C=O)C4CCC(C)C4CC2(COC24OC5OC(C(OC(=O)Cc6ccccc6)C5O2)C4O)C13C(=O)O |
| InChI | InChI=1S/C34H40O10/c1-17(2)23-12-20-13-31(15-35)22-10-9-18(3)21(22)14-32(20,33(23,31)30(38)39)16-40-34-28(37)26-25(27(43-34)29(42-26)44-34)41-24(36)11-19-7-5-4-6-8-19/h4-8,12,15,17-18,20-22,25-29,37H,9-11,13-14,16H2,1-3H3,(H,38,39) |
| InChIKey | GIJWWUQSTBZNPQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|