C20H22FNO6S — CID 18703979
4-[[4-[1-(4-fluorophenyl)ethoxy]phenyl]sulfonylamino]oxane-4-carboxylic acid (PubChem CID 18703979) has the molecular formula C20H22FNO6S and a molecular weight of 423.46 g/mol. Its IUPAC name is 4-[[4-[1-(4-fluorophenyl)ethoxy]phenyl]sulfonylamino]oxane-4-carboxylic acid.
| Compound Name | 4-[[4-[1-(4-fluorophenyl)ethoxy]phenyl]sulfonylamino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 18703979 |
| Molecular Formula | C20H22FNO6S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-[[4-[1-(4-fluorophenyl)ethoxy]phenyl]sulfonylamino]oxane-4-carboxylic acid |
| SMILES | CC(Oc1ccc(S(=O)(=O)NC2(C(=O)O)CCOCC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO6S/c1-14(15-2-4-16(21)5-3-15)28-17-6-8-18(9-7-17)29(25,26)22-20(19(23)24)10-12-27-13-11-20/h2-9,14,22H,10-13H2,1H3,(H,23,24) |
| InChIKey | JCLCNNAWSZGLGB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |