About N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine
N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine (PubChem CID 18704303) has the molecular formula C12H29NSi2
and a molecular weight of 243.54 g/mol. Its IUPAC name is N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine.
Molecular Properties
| Compound Name | N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine |
| PubChem CID | 18704303 |
| Molecular Formula | C12H29NSi2 |
| Molecular Weight | 243.54 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine |
| SMILES | C=CCN([Si](C)(C)C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C12H29NSi2/c1-8-12-13(14(5,6)7)15(9-2,10-3)11-4/h8H,1,9-12H2,2-7H3 |
| InChIKey | XQFNBHCJFKGKNQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine?
The IUPAC name of N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine (CID 18704303) is N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine.
What is the SMILES notation for N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine?
The canonical SMILES for N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine is C=CCN([Si](C)(C)C)[Si](CC)(CC)CC.
What is the InChIKey of N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine?
The InChIKey is XQFNBHCJFKGKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H29NSi2/c1-8-12-13(14(5,6)7)15(9-2,10-3)11-4/h8H,1,9-12H2,2-7H3.
What are the key properties of N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine?
N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine has a molecular weight of 243.54 g/mol, XLogP of 4.31, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-triethylsilyl-N-trimethylsilylprop-2-en-1-amine is sourced from PubChem (CID 18704303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).