C29H42O4S — CID 18704334
[(2E,6E,10E)-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 18704334) has the molecular formula C29H42O4S and a molecular weight of 486.72 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [(2E,6E,10E)-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 18704334 |
| Molecular Formula | C29H42O4S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | [(2E,6E,10E)-3,7,11,15-tetramethyl-9-(4-methylphenyl)sulfonylhexadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CC(/C=C(\C)CCC=C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H42O4S/c1-22(2)10-8-12-25(5)20-29(34(31,32)28-16-14-24(4)15-17-28)21-26(6)13-9-11-23(3)18-19-33-27(7)30/h10,13-18,20,29H,8-9,11-12,19,21H2,1-7H3/b23-18+,25-20+,26-13+ |
| InChIKey | SKXXVSKLUXUWPZ-PMVQLJKDSA-N |
| XLogP | 7.46 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|