About 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane
3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane (PubChem CID 18704343) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane.
Molecular Properties
| Compound Name | 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane |
| PubChem CID | 18704343 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane |
| SMILES | CC(C)CC(C)(C)CC1(C(C)(C)C)OO1 |
| InChI | InChI=1S/C13H26O2/c1-10(2)8-12(6,7)9-13(14-15-13)11(3,4)5/h10H,8-9H2,1-7H3 |
| InChIKey | QVXFNBCKGYWJHJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane?
The IUPAC name of 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane (CID 18704343) is 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane.
What is the SMILES notation for 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane?
The canonical SMILES for 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane is CC(C)CC(C)(C)CC1(C(C)(C)C)OO1.
What is the InChIKey of 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane?
The InChIKey is QVXFNBCKGYWJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-10(2)8-12(6,7)9-13(14-15-13)11(3,4)5/h10H,8-9H2,1-7H3.
What are the key properties of 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane?
3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane has a molecular weight of 214.35 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-3-(2,2,4-trimethylpentyl)dioxirane is sourced from PubChem (CID 18704343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).