C19H18Cl2N2O6S — CID 18704938
[3-[acetyl(methyl)amino]-2,6-dichlorophenyl]methyl methanesulfonate;isoindole-1,3-dione (PubChem CID 18704938) has the molecular formula C19H18Cl2N2O6S and a molecular weight of 473.33 g/mol. Its IUPAC name is [3-[acetyl(methyl)amino]-2,6-dichlorophenyl]methyl methanesulfonate;isoindole-1,3-dione.
| Compound Name | [3-[acetyl(methyl)amino]-2,6-dichlorophenyl]methyl methanesulfonate;isoindole-1,3-dione |
|---|---|
| PubChem CID | 18704938 |
| Molecular Formula | C19H18Cl2N2O6S |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | [3-[acetyl(methyl)amino]-2,6-dichlorophenyl]methyl methanesulfonate;isoindole-1,3-dione |
| SMILES | CC(=O)N(C)c1ccc(Cl)c(COS(C)(=O)=O)c1Cl.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C11H13Cl2NO4S.C8H5NO2/c1-7(15)14(2)10-5-4-9(12)8(11(10)13)6-18-19(3,16)17;10-7-5-3-1-2-4-6(5)8(11)9-7/h4-5H,6H2,1-3H3;1-4H,(H,9,10,11) |
| InChIKey | CLRITFINJYPKQS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|