C24H34O2 — CID 18705081
(2E,4E,6Z)-7-(3,5-ditert-butylphenyl)-3-methylnona-2,4,6-trienoic acid (PubChem CID 18705081) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (2E,4E,6Z)-7-(3,5-ditert-butylphenyl)-3-methylnona-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6Z)-7-(3,5-ditert-butylphenyl)-3-methylnona-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 18705081 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (2E,4E,6Z)-7-(3,5-ditert-butylphenyl)-3-methylnona-2,4,6-trienoic acid |
| SMILES | CC/C(=C/C=C/C(C)=C/C(=O)O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H34O2/c1-9-18(12-10-11-17(2)13-22(25)26)19-14-20(23(3,4)5)16-21(15-19)24(6,7)8/h10-16H,9H2,1-8H3,(H,25,26)/b11-10+,17-13+,18-12- |
| InChIKey | WIRGRVWHLYEWKI-ISRUEKLASA-N |
| XLogP | 6.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|