About 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile
2-methylbuta-1,3-diene;2-methylprop-2-enenitrile (PubChem CID 18705378) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile |
| PubChem CID | 18705378 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile |
| SMILES | C=C(C)C#N.C=CC(=C)C |
| InChI | InChI=1S/C5H8.C4H5N/c1-4-5(2)3;1-4(2)3-5/h4H,1-2H2,3H3;1H2,2H3 |
| InChIKey | BWWGCYCYDNBYOW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
The IUPAC name of 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile (CID 18705378) is 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile.
What is the SMILES notation for 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
The canonical SMILES for 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile is C=C(C)C#N.C=CC(=C)C.
What is the InChIKey of 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
The InChIKey is BWWGCYCYDNBYOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.C4H5N/c1-4-5(2)3;1-4(2)3-5/h4H,1-2H2,3H3;1H2,2H3.
What are the key properties of 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile?
2-methylbuta-1,3-diene;2-methylprop-2-enenitrile has a molecular weight of 135.21 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-diene;2-methylprop-2-enenitrile is sourced from PubChem (CID 18705378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).