C20H31N4P — CID 18705990
2-[2,6-bis(dimethylamino)phenyl]phosphanyl-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine (PubChem CID 18705990) has the molecular formula C20H31N4P and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-[2,6-bis(dimethylamino)phenyl]phosphanyl-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine.
| Compound Name | 2-[2,6-bis(dimethylamino)phenyl]phosphanyl-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 18705990 |
| Molecular Formula | C20H31N4P |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 2-[2,6-bis(dimethylamino)phenyl]phosphanyl-1-N,1-N,3-N,3-N-tetramethylbenzene-1,3-diamine |
| SMILES | CN(C)c1cccc(N(C)C)c1Pc1c(N(C)C)cccc1N(C)C |
| InChI | InChI=1S/C20H31N4P/c1-21(2)15-11-9-12-16(22(3)4)19(15)25-20-17(23(5)6)13-10-14-18(20)24(7)8/h9-14,25H,1-8H3 |
| InChIKey | FDMGTQUZSMPDJR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|