C17H13BrN4O5 — CID 18706300
N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-(3-nitrophenyl)acetamide (PubChem CID 18706300) has the molecular formula C17H13BrN4O5 and a molecular weight of 433.22 g/mol. Its IUPAC name is N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-(3-nitrophenyl)acetamide.
| Compound Name | N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 18706300 |
| Molecular Formula | C17H13BrN4O5 |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-(3-nitrophenyl)acetamide |
| SMILES | O=C(Cc1cccc([N+](=O)[O-])c1)NCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C17H13BrN4O5/c18-11-6-10(15-13(7-11)20-16(24)17(25)21-15)8-19-14(23)5-9-2-1-3-12(4-9)22(26)27/h1-4,6-7H,5,8H2,(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | FJKKVOAZFMLBII-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|