C11H7BrF3N3O3 — CID 18706416
N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 18706416) has the molecular formula C11H7BrF3N3O3 and a molecular weight of 366.09 g/mol. Its IUPAC name is N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 18706416 |
| Molecular Formula | C11H7BrF3N3O3 |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12)C(F)(F)F |
| InChI | InChI=1S/C11H7BrF3N3O3/c12-5-1-4(3-16-10(21)11(13,14)15)7-6(2-5)17-8(19)9(20)18-7/h1-2H,3H2,(H,16,21)(H,17,19)(H,18,20) |
| InChIKey | RMOZLMCDJNUJJP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|