C15H16BrN3O4 — CID 18706487
[1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrrolidin-3-yl] acetate (PubChem CID 18706487) has the molecular formula C15H16BrN3O4 and a molecular weight of 382.21 g/mol. Its IUPAC name is [1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrrolidin-3-yl] acetate.
| Compound Name | [1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 18706487 |
| Molecular Formula | C15H16BrN3O4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | [1-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]pyrrolidin-3-yl] acetate |
| SMILES | CC(=O)OC1CCN(Cc2cc(Br)cc3[nH]c(=O)c(=O)[nH]c23)C1 |
| InChI | InChI=1S/C15H16BrN3O4/c1-8(20)23-11-2-3-19(7-11)6-9-4-10(16)5-12-13(9)18-15(22)14(21)17-12/h4-5,11H,2-3,6-7H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | LCQKZJLWOJOOSV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|