C12H14N4O4 — CID 18706560
7-nitro-5-[(propan-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 18706560) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 7-nitro-5-[(propan-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 7-nitro-5-[(propan-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 18706560 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 7-nitro-5-[(propan-2-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | CC(C)NCc1cc([N+](=O)[O-])cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C12H14N4O4/c1-6(2)13-5-7-3-8(16(19)20)4-9-10(7)15-12(18)11(17)14-9/h3-4,6,13H,5H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | XQFRCNUYGYWDFG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|