C17H14BrN3O3 — CID 18706638
N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-phenylacetamide (PubChem CID 18706638) has the molecular formula C17H14BrN3O3 and a molecular weight of 388.22 g/mol. Its IUPAC name is N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-phenylacetamide.
| Compound Name | N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 18706638 |
| Molecular Formula | C17H14BrN3O3 |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C17H14BrN3O3/c18-12-7-11(15-13(8-12)20-16(23)17(24)21-15)9-19-14(22)6-10-4-2-1-3-5-10/h1-5,7-8H,6,9H2,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | WOGATXNLOVWIQG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|