C14H12BrN5O4 — CID 18706695
7-nitro-5-[(pyridin-3-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;hydrobromide (PubChem CID 18706695) has the molecular formula C14H12BrN5O4 and a molecular weight of 394.19 g/mol. Its IUPAC name is 7-nitro-5-[(pyridin-3-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;hydrobromide.
| Compound Name | 7-nitro-5-[(pyridin-3-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;hydrobromide |
|---|---|
| PubChem CID | 18706695 |
| Molecular Formula | C14H12BrN5O4 |
| Molecular Weight | 394.19 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 7-nitro-5-[(pyridin-3-ylamino)methyl]-1,4-dihydroquinoxaline-2,3-dione;hydrobromide |
| SMILES | Br.O=c1[nH]c2cc([N+](=O)[O-])cc(CNc3cccnc3)c2[nH]c1=O |
| InChI | InChI=1S/C14H11N5O4.BrH/c20-13-14(21)18-12-8(6-16-9-2-1-3-15-7-9)4-10(19(22)23)5-11(12)17-13;/h1-5,7,16H,6H2,(H,17,20)(H,18,21);1H |
| InChIKey | REDGFUJNAOMQCX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|