C12H12BrN3O4 — CID 18706705
3-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid (PubChem CID 18706705) has the molecular formula C12H12BrN3O4 and a molecular weight of 342.15 g/mol. Its IUPAC name is 3-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid.
| Compound Name | 3-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 18706705 |
| Molecular Formula | C12H12BrN3O4 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 3-[(7-bromo-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1cc(Br)cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C12H12BrN3O4/c13-7-3-6(5-14-2-1-9(17)18)10-8(4-7)15-11(19)12(20)16-10/h3-4,14H,1-2,5H2,(H,15,19)(H,16,20)(H,17,18) |
| InChIKey | RZDPWUBOSAGJON-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|