C19H18N4O8 — CID 18706742
3,4,5-trimethoxy-N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]benzamide (PubChem CID 18706742) has the molecular formula C19H18N4O8 and a molecular weight of 430.37 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 18706742 |
| Molecular Formula | C19H18N4O8 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(7-nitro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2cc([N+](=O)[O-])cc3[nH]c(=O)c(=O)[nH]c23)cc(OC)c1OC |
| InChI | InChI=1S/C19H18N4O8/c1-29-13-5-9(6-14(30-2)16(13)31-3)17(24)20-8-10-4-11(23(27)28)7-12-15(10)22-19(26)18(25)21-12/h4-7H,8H2,1-3H3,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | NUAVKAPDVFGXTQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 165.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|