C24H28N2O2 — CID 18706948
4-[6-[3-(dimethylamino)propoxymethyl]-2-ethyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaen-3-yl]phenol (PubChem CID 18706948) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[6-[3-(dimethylamino)propoxymethyl]-2-ethyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaen-3-yl]phenol.
| Compound Name | 4-[6-[3-(dimethylamino)propoxymethyl]-2-ethyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaen-3-yl]phenol |
|---|---|
| PubChem CID | 18706948 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 4-[6-[3-(dimethylamino)propoxymethyl]-2-ethyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaen-3-yl]phenol |
| SMILES | CCc1c(-c2ccc(O)cc2)c2cc(COCCCN(C)C)c3cccc1n32 |
| InChI | InChI=1S/C24H28N2O2/c1-4-20-22-8-5-7-21-18(16-28-14-6-13-25(2)3)15-23(26(21)22)24(20)17-9-11-19(27)12-10-17/h5,7-12,15,27H,4,6,13-14,16H2,1-3H3 |
| InChIKey | IAEVDBIZALQZIW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|