C25H26N2O5 — CID 18707076
dimethyl 3-hydroxy-4,7-bis(4-methylphenyl)-4,7-dihydro-3H-pyrazolo[1,5-a]pyridine-2,3a-dicarboxylate (PubChem CID 18707076) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is dimethyl 3-hydroxy-4,7-bis(4-methylphenyl)-4,7-dihydro-3H-pyrazolo[1,5-a]pyridine-2,3a-dicarboxylate.
| Compound Name | dimethyl 3-hydroxy-4,7-bis(4-methylphenyl)-4,7-dihydro-3H-pyrazolo[1,5-a]pyridine-2,3a-dicarboxylate |
|---|---|
| PubChem CID | 18707076 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | dimethyl 3-hydroxy-4,7-bis(4-methylphenyl)-4,7-dihydro-3H-pyrazolo[1,5-a]pyridine-2,3a-dicarboxylate |
| SMILES | COC(=O)C1=NN2C(c3ccc(C)cc3)C=CC(c3ccc(C)cc3)C2(C(=O)OC)C1O |
| InChI | InChI=1S/C25H26N2O5/c1-15-5-9-17(10-6-15)19-13-14-20(18-11-7-16(2)8-12-18)27-25(19,24(30)32-4)22(28)21(26-27)23(29)31-3/h5-14,19-20,22,28H,1-4H3 |
| InChIKey | UZXPNWPCJGUMLX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|