About 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole
2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole (PubChem CID 18707293) has the molecular formula C8H9NS2
and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole |
| PubChem CID | 18707293 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole |
| SMILES | CSC1Nc2ccccc2S1 |
| InChI | InChI=1S/C8H9NS2/c1-10-8-9-6-4-2-3-5-7(6)11-8/h2-5,8-9H,1H3 |
| InChIKey | LFQQXNDWBQWJRW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole?
The IUPAC name of 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole (CID 18707293) is 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole.
What is the SMILES notation for 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole?
The canonical SMILES for 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole is CSC1Nc2ccccc2S1.
What is the InChIKey of 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole?
The InChIKey is LFQQXNDWBQWJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS2/c1-10-8-9-6-4-2-3-5-7(6)11-8/h2-5,8-9H,1H3.
What are the key properties of 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole?
2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole has a molecular weight of 183.30 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-2,3-dihydro-1,3-benzothiazole is sourced from PubChem (CID 18707293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).