C27H41N3O4 — CID 18707439
6-[6-[2-[(3-methoxy-2-pyridinyl)oxy]ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol (PubChem CID 18707439) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is 6-[6-[2-[(3-methoxy-2-pyridinyl)oxy]ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol.
| Compound Name | 6-[6-[2-[(3-methoxy-2-pyridinyl)oxy]ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 18707439 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 6-[6-[2-[(3-methoxy-2-pyridinyl)oxy]ethylamino]hexyl-propylamino]-5,6,7,8-tetrahydronaphthalene-1,2-diol |
| SMILES | CCCN(CCCCCCNCCOc1ncccc1OC)C1CCc2c(ccc(O)c2O)C1 |
| InChI | InChI=1S/C27H41N3O4/c1-3-17-30(22-11-12-23-21(20-22)10-13-24(31)26(23)32)18-7-5-4-6-14-28-16-19-34-27-25(33-2)9-8-15-29-27/h8-10,13,15,22,28,31-32H,3-7,11-12,14,16-20H2,1-2H3 |
| InChIKey | FMQBXYXNNHPAGR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|