C7H8N4O2S3 — CID 18707638
5-methylsulfonyl-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole (PubChem CID 18707638) has the molecular formula C7H8N4O2S3 and a molecular weight of 276.37 g/mol. Its IUPAC name is 5-methylsulfonyl-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 5-methylsulfonyl-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 18707638 |
| Molecular Formula | C7H8N4O2S3 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 5-methylsulfonyl-2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
| SMILES | Cc1nc(Sc2ncc(S(C)(=O)=O)s2)n[nH]1 |
| InChI | InChI=1S/C7H8N4O2S3/c1-4-9-6(11-10-4)15-7-8-3-5(14-7)16(2,12)13/h3H,1-2H3,(H,9,10,11) |
| InChIKey | IBTJIPBWRKXDGB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|