C11H7N3OS2 — CID 18707640
5-(5-phenyl-1,3-oxazol-4-yl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 18707640) has the molecular formula C11H7N3OS2 and a molecular weight of 261.33 g/mol. Its IUPAC name is 5-(5-phenyl-1,3-oxazol-4-yl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(5-phenyl-1,3-oxazol-4-yl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 18707640 |
| Molecular Formula | C11H7N3OS2 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 5-(5-phenyl-1,3-oxazol-4-yl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2ncoc2-c2ccccc2)s1 |
| InChI | InChI=1S/C11H7N3OS2/c16-11-14-13-10(17-11)8-9(15-6-12-8)7-4-2-1-3-5-7/h1-6H,(H,14,16) |
| InChIKey | MOLLRFXLGLAEQX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|